C21H21FN2O5 — CID 141216489
2-(2-ethoxyethoxy)-5-[(3-fluorophenyl)methoxy]-N-(1,2-oxazol-3-yl)benzamide (PubChem CID 141216489) has the molecular formula C21H21FN2O5 and a molecular weight of 400.41 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-5-[(3-fluorophenyl)methoxy]-N-(1,2-oxazol-3-yl)benzamide.
| Compound Name | 2-(2-ethoxyethoxy)-5-[(3-fluorophenyl)methoxy]-N-(1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 141216489 |
| Molecular Formula | C21H21FN2O5 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(2-ethoxyethoxy)-5-[(3-fluorophenyl)methoxy]-N-(1,2-oxazol-3-yl)benzamide |
| SMILES | CCOCCOc1ccc(OCc2cccc(F)c2)cc1C(=O)Nc1ccon1 |
| InChI | InChI=1S/C21H21FN2O5/c1-2-26-10-11-27-19-7-6-17(28-14-15-4-3-5-16(22)12-15)13-18(19)21(25)23-20-8-9-29-24-20/h3-9,12-13H,2,10-11,14H2,1H3,(H,23,24,25) |
| InChIKey | COOOKQMTXCZQPK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|