C8H10N4O2 — CID 141216690
1-propyl-3,4-dihydropurine-2,6-dione (PubChem CID 141216690) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-propyl-3,4-dihydropurine-2,6-dione.
| Compound Name | 1-propyl-3,4-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 141216690 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-propyl-3,4-dihydropurine-2,6-dione |
| SMILES | CCCN1C(=O)NC2N=CN=C2C1=O |
| InChI | InChI=1S/C8H10N4O2/c1-2-3-12-7(13)5-6(10-4-9-5)11-8(12)14/h4,6H,2-3H2,1H3,(H,11,14) |
| InChIKey | DXMWTXSLPFAHLM-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |