C5H6N4O2 — CID 68954885
3,4,8,9-tetrahydropurine-2,6-dione (PubChem CID 68954885) has the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. Its IUPAC name is 3,4,8,9-tetrahydropurine-2,6-dione.
| Compound Name | 3,4,8,9-tetrahydropurine-2,6-dione |
|---|---|
| PubChem CID | 68954885 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 3,4,8,9-tetrahydropurine-2,6-dione |
| SMILES | O=C1NC(=O)C2=NCNC2N1 |
| InChI | InChI=1S/C5H6N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h3,7H,1H2,(H2,8,9,10,11) |
| InChIKey | GDNTXIHBWIRPMT-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |