C4H5N3O2 — CID 91071412
5-imino-1,3-diazinane-2,4-dione (PubChem CID 91071412) has the molecular formula C4H5N3O2 and a molecular weight of 127.10 g/mol. Its IUPAC name is 5-imino-1,3-diazinane-2,4-dione.
| Compound Name | 5-imino-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 91071412 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 5-imino-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\CNC(=O)NC1=O |
| InChI | InChI=1S/C4H5N3O2/c5-2-1-6-4(9)7-3(2)8/h5H,1H2,(H2,6,7,8,9)/b5-2+ |
| InChIKey | ADEHTDRHFOVNGL-GORDUTHDSA-N |
| XLogP | -1.15 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|