C6H6N4O3 — CID 23617137
3-methyl-4,9-dihydropurine-2,6,8-trione (PubChem CID 23617137) has the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. Its IUPAC name is 3-methyl-4,9-dihydropurine-2,6,8-trione.
| Compound Name | 3-methyl-4,9-dihydropurine-2,6,8-trione |
|---|---|
| PubChem CID | 23617137 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 3-methyl-4,9-dihydropurine-2,6,8-trione |
| SMILES | CN1C(=O)NC(=O)C2=NC(=O)NC21 |
| InChI | InChI=1S/C6H6N4O3/c1-10-3-2(7-5(12)8-3)4(11)9-6(10)13/h3H,1H3,(H,8,12)(H,9,11,13) |
| InChIKey | MMZXKYHDZDOYOG-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |