C13H24O2 — CID 141216696
2-methyl-4-(2,2,3-trimethylcyclopentyl)butanoic acid (PubChem CID 141216696) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-methyl-4-(2,2,3-trimethylcyclopentyl)butanoic acid.
| Compound Name | 2-methyl-4-(2,2,3-trimethylcyclopentyl)butanoic acid |
|---|---|
| PubChem CID | 141216696 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-methyl-4-(2,2,3-trimethylcyclopentyl)butanoic acid |
| SMILES | CC(CCC1CCC(C)C1(C)C)C(=O)O |
| InChI | InChI=1S/C13H24O2/c1-9(12(14)15)5-7-11-8-6-10(2)13(11,3)4/h9-11H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | VZQYDMJKVVCSGZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |