C21H24FN3OS — CID 141219093
N-[(2R)-1-(4-fluorophenyl)-3-sulfanylpropan-2-yl]-7-methyl-2-propyl-3H-benzimidazole-5-carboxamide (PubChem CID 141219093) has the molecular formula C21H24FN3OS and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[(2R)-1-(4-fluorophenyl)-3-sulfanylpropan-2-yl]-7-methyl-2-propyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(2R)-1-(4-fluorophenyl)-3-sulfanylpropan-2-yl]-7-methyl-2-propyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 141219093 |
| Molecular Formula | C21H24FN3OS |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[(2R)-1-(4-fluorophenyl)-3-sulfanylpropan-2-yl]-7-methyl-2-propyl-3H-benzimidazole-5-carboxamide |
| SMILES | CCCc1nc2c(C)cc(C(=O)N[C@@H](CS)Cc3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C21H24FN3OS/c1-3-4-19-24-18-11-15(9-13(2)20(18)25-19)21(26)23-17(12-27)10-14-5-7-16(22)8-6-14/h5-9,11,17,27H,3-4,10,12H2,1-2H3,(H,23,26)(H,24,25)/t17-/m1/s1 |
| InChIKey | VTIYLENSSDFTCW-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|