C20H28O — CID 141222018
(8S,9S,10R,13S,14S)-13-ethyl-10-methyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 141222018) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-13-ethyl-10-methyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S)-13-ethyl-10-methyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 141222018 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (8S,9S,10R,13S,14S)-13-ethyl-10-methyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC[C@@]12CCC[C@H]1[C@@H]1C=CC3=CC(=O)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C20H28O/c1-3-20-10-4-5-18(20)16-7-6-14-13-15(21)8-11-19(14,2)17(16)9-12-20/h6-7,13,16-18H,3-5,8-12H2,1-2H3/t16-,17+,18+,19+,20+/m1/s1 |
| InChIKey | FZDJEONKONFNCR-DEPCRRQNSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |