C19H23IO — CID 67975988
(10R,13S)-17-iodo-10,13-dimethyl-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67975988) has the molecular formula C19H23IO and a molecular weight of 394.30 g/mol. Its IUPAC name is (10R,13S)-17-iodo-10,13-dimethyl-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S)-17-iodo-10,13-dimethyl-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67975988 |
| Molecular Formula | C19H23IO |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (10R,13S)-17-iodo-10,13-dimethyl-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1C=CC1C2CC[C@]2(C)C(I)=CCC12 |
| InChI | InChI=1S/C19H23IO/c1-18-9-7-13(21)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h3-4,6,11,14-16H,5,7-10H2,1-2H3/t14?,15?,16?,18-,19-/m0/s1 |
| InChIKey | DZHUEOOCVPUSMH-WFZCBACDSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|