C19H18O6 — CID 141227516
1-ethylperoxy-6,7-dimethoxyphenanthrene-9-carboxylic acid (PubChem CID 141227516) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-ethylperoxy-6,7-dimethoxyphenanthrene-9-carboxylic acid.
| Compound Name | 1-ethylperoxy-6,7-dimethoxyphenanthrene-9-carboxylic acid |
|---|---|
| PubChem CID | 141227516 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 1-ethylperoxy-6,7-dimethoxyphenanthrene-9-carboxylic acid |
| SMILES | CCOOc1cccc2c1cc(C(=O)O)c1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C19H18O6/c1-4-24-25-16-7-5-6-11-12-9-17(22-2)18(23-3)10-13(12)15(19(20)21)8-14(11)16/h5-10H,4H2,1-3H3,(H,20,21) |
| InChIKey | OPKDBBHRCOPHQA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|