C20H27FN4O4S — CID 141227583
4-ethyl-2-[5-(3-fluoro-4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1H-pyrimidin-6-one (PubChem CID 141227583) has the molecular formula C20H27FN4O4S and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-ethyl-2-[5-(3-fluoro-4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1H-pyrimidin-6-one.
| Compound Name | 4-ethyl-2-[5-(3-fluoro-4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 141227583 |
| Molecular Formula | C20H27FN4O4S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-ethyl-2-[5-(3-fluoro-4-methylpiperazin-1-yl)sulfonyl-2-propoxyphenyl]-1H-pyrimidin-6-one |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(C)C(F)C2)cc1-c1nc(CC)cc(=O)[nH]1 |
| InChI | InChI=1S/C20H27FN4O4S/c1-4-10-29-17-7-6-15(30(27,28)25-9-8-24(3)18(21)13-25)12-16(17)20-22-14(5-2)11-19(26)23-20/h6-7,11-12,18H,4-5,8-10,13H2,1-3H3,(H,22,23,26) |
| InChIKey | GKPHGMYFQWPMAP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|