C31H47N3O2 — CID 141228600
2-[2-[1-[9-(1-hydroxypropan-2-ylamino)nonyl]piperidin-4-yl]phenyl]-2-phenylacetamide (PubChem CID 141228600) has the molecular formula C31H47N3O2 and a molecular weight of 493.74 g/mol. Its IUPAC name is 2-[2-[1-[9-(1-hydroxypropan-2-ylamino)nonyl]piperidin-4-yl]phenyl]-2-phenylacetamide.
| Compound Name | 2-[2-[1-[9-(1-hydroxypropan-2-ylamino)nonyl]piperidin-4-yl]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 141228600 |
| Molecular Formula | C31H47N3O2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.37 |
| IUPAC Name | 2-[2-[1-[9-(1-hydroxypropan-2-ylamino)nonyl]piperidin-4-yl]phenyl]-2-phenylacetamide |
| SMILES | CC(CO)NCCCCCCCCCN1CCC(c2ccccc2C(C(N)=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H47N3O2/c1-25(24-35)33-20-12-5-3-2-4-6-13-21-34-22-18-26(19-23-34)28-16-10-11-17-29(28)30(31(32)36)27-14-8-7-9-15-27/h7-11,14-17,25-26,30,33,35H,2-6,12-13,18-24H2,1H3,(H2,32,36) |
| InChIKey | LDJCKVKTTSFFNE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|