C20H20Cl3FO3S — CID 141229648
2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(hydroxymethyl)phenyl]methyl]butanoate (PubChem CID 141229648) has the molecular formula C20H20Cl3FO3S and a molecular weight of 465.80 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(hydroxymethyl)phenyl]methyl]butanoate.
| Compound Name | 2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(hydroxymethyl)phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 141229648 |
| Molecular Formula | C20H20Cl3FO3S |
| Molecular Weight | 465.80 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 2,2,2-trichloroethyl 4-(4-fluorophenyl)sulfanyl-2-[[4-(hydroxymethyl)phenyl]methyl]butanoate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)C(CCSc1ccc(F)cc1)Cc1ccc(CO)cc1 |
| InChI | InChI=1S/C20H20Cl3FO3S/c21-20(22,23)13-27-19(26)16(11-14-1-3-15(12-25)4-2-14)9-10-28-18-7-5-17(24)6-8-18/h1-8,16,25H,9-13H2 |
| InChIKey | LROKBGATDSQYNG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|