C10H13BrN2O2 — CID 141229872
(3,5,6-trimethylpyrazin-2-yl)methyl 2-bromoacetate (PubChem CID 141229872) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is (3,5,6-trimethylpyrazin-2-yl)methyl 2-bromoacetate.
| Compound Name | (3,5,6-trimethylpyrazin-2-yl)methyl 2-bromoacetate |
|---|---|
| PubChem CID | 141229872 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (3,5,6-trimethylpyrazin-2-yl)methyl 2-bromoacetate |
| SMILES | Cc1nc(C)c(COC(=O)CBr)nc1C |
| InChI | InChI=1S/C10H13BrN2O2/c1-6-7(2)13-9(8(3)12-6)5-15-10(14)4-11/h4-5H2,1-3H3 |
| InChIKey | APKXZLTUZBLNHC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|