C12H20N2O2 — CID 141337777
2,5-bis(ethoxymethyl)-3,6-dimethylpyrazine (PubChem CID 141337777) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,5-bis(ethoxymethyl)-3,6-dimethylpyrazine.
| Compound Name | 2,5-bis(ethoxymethyl)-3,6-dimethylpyrazine |
|---|---|
| PubChem CID | 141337777 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2,5-bis(ethoxymethyl)-3,6-dimethylpyrazine |
| SMILES | CCOCc1nc(C)c(COCC)nc1C |
| InChI | InChI=1S/C12H20N2O2/c1-5-15-7-11-9(3)14-12(8-16-6-2)10(4)13-11/h5-8H2,1-4H3 |
| InChIKey | TYGIRZRCNKXNRD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |