C55H52N8O3 — CID 141231232
N'-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carbohydrazide (PubChem CID 141231232) has the molecular formula C55H52N8O3 and a molecular weight of 873.07 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carbohydrazide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 141231232 |
| Molecular Formula | C55H52N8O3 |
| Molecular Weight | 873.07 g/mol |
| Exact Mass | 872.42 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)ethyl]-7-methyl-2-propyl-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carbohydrazide |
| SMILES | CCCc1nc2c(C)cc(C(=O)NNCCc3ccc(OC)c(OC)c3)cc2n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C55H52N8O3/c1-5-17-51-57-52-38(2)34-42(54(64)59-56-33-32-39-28-31-49(65-3)50(35-39)66-4)36-48(52)62(51)37-40-26-29-41(30-27-40)46-24-15-16-25-47(46)53-58-60-61-63(53)55(43-18-9-6-10-19-43,44-20-11-7-12-21-44)45-22-13-8-14-23-45/h6-16,18-31,34-36,56H,5,17,32-33,37H2,1-4H3,(H,59,64) |
| InChIKey | VDGHPOXPDBMCLZ-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.07 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|