C33H35FN6O3Si — CID 141231971
N-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorophenyl]methyl]-2-methyl-6-(1H-1,2,4-triazol-5-yl)pyrimidine-4-carboxamide (PubChem CID 141231971) has the molecular formula C33H35FN6O3Si and a molecular weight of 610.77 g/mol. Its IUPAC name is N-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorophenyl]methyl]-2-methyl-6-(1H-1,2,4-triazol-5-yl)pyrimidine-4-carboxamide.
| Compound Name | N-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorophenyl]methyl]-2-methyl-6-(1H-1,2,4-triazol-5-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 141231971 |
| Molecular Formula | C33H35FN6O3Si |
| Molecular Weight | 610.77 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | N-[[3-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-4-fluorophenyl]methyl]-2-methyl-6-(1H-1,2,4-triazol-5-yl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCc2ccc(F)c(OCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)cc(-c2ncn[nH]2)n1 |
| InChI | InChI=1S/C33H35FN6O3Si/c1-23-38-28(31-36-22-37-40-31)20-29(39-23)32(41)35-21-24-15-16-27(34)30(19-24)42-17-18-43-44(33(2,3)4,25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-16,19-20,22H,17-18,21H2,1-4H3,(H,35,41)(H,36,37,40) |
| InChIKey | BCIHWKJTYRGLEQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|