C17H20N2O5 — CID 141232269
ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate (PubChem CID 141232269) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate.
| Compound Name | ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 141232269 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate |
| SMILES | CCOC(=O)c1cc(OC)c(OCc2cnc(C)cn2)c(OC)c1 |
| InChI | InChI=1S/C17H20N2O5/c1-5-23-17(20)12-6-14(21-3)16(15(7-12)22-4)24-10-13-9-18-11(2)8-19-13/h6-9H,5,10H2,1-4H3 |
| InChIKey | FVWMOHZUQPIAMB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |