ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate

C17H20N2O5 — CID 141232269

IUPACethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate
SMILESCCOC(=O)c1cc(OC)c(OCc2cnc(C)cn2)c(OC)c1
InChIInChI=1S/C17H20N2O5/c1-5-23-17(20)12-6-14(21-3)16(15(7-12)22-4)24-10-13-9-18-11(2)8-19-13/h6-9H,5,10H2,1-4H3
InChIKeyFVWMOHZUQPIAMB-UHFFFAOYSA-N
MW332.36 g/mol
LogP2.56
Rot. Bonds7

About ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate

ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate (PubChem CID 141232269) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate.

Molecular Properties

Compound Nameethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate
PubChem CID141232269
Molecular FormulaC17H20N2O5
Molecular Weight332.36 g/mol
Exact Mass332.14
IUPAC Nameethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate
SMILESCCOC(=O)c1cc(OC)c(OCc2cnc(C)cn2)c(OC)c1
InChIInChI=1S/C17H20N2O5/c1-5-23-17(20)12-6-14(21-3)16(15(7-12)22-4)24-10-13-9-18-11(2)8-19-13/h6-9H,5,10H2,1-4H3
InChIKeyFVWMOHZUQPIAMB-UHFFFAOYSA-N
XLogP2.56
TPSA79.77 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.36
LogP ≤ 52.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate?
The IUPAC name of ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate (CID 141232269) is ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate.
What is the SMILES notation for ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate?
The canonical SMILES for ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate is CCOC(=O)c1cc(OC)c(OCc2cnc(C)cn2)c(OC)c1.
What is the InChIKey of ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate?
The InChIKey is FVWMOHZUQPIAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O5/c1-5-23-17(20)12-6-14(21-3)16(15(7-12)22-4)24-10-13-9-18-11(2)8-19-13/h6-9H,5,10H2,1-4H3.
What are the key properties of ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate?
ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate has a molecular weight of 332.36 g/mol, XLogP of 2.56, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dimethoxy-4-[(5-methylpyrazin-2-yl)methoxy]benzoate is sourced from PubChem (CID 141232269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).