C30H40F2O4S2 — CID 141233019
[1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 2-(1-adamantyl)-1,1-difluoroethanesulfonate (PubChem CID 141233019) has the molecular formula C30H40F2O4S2 and a molecular weight of 566.78 g/mol. Its IUPAC name is [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 2-(1-adamantyl)-1,1-difluoroethanesulfonate.
| Compound Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 2-(1-adamantyl)-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 141233019 |
| Molecular Formula | C30H40F2O4S2 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 2-(1-adamantyl)-1,1-difluoroethanesulfonate |
| SMILES | CCCCOc1ccc(S2(OS(=O)(=O)C(F)(F)CC34CC5CC(CC(C5)C3)C4)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C30H40F2O4S2/c1-2-3-12-35-27-10-11-28(26-9-5-4-8-25(26)27)37(13-6-7-14-37)36-38(33,34)30(31,32)21-29-18-22-15-23(19-29)17-24(16-22)20-29/h4-5,8-11,22-24H,2-3,6-7,12-21H2,1H3 |
| InChIKey | BXYWYKPGHJARCY-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|