C23H28ClN3S — CID 141234580
4-tert-butyl-5-[(4-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-1,3-thiazol-2-amine (PubChem CID 141234580) has the molecular formula C23H28ClN3S and a molecular weight of 414.02 g/mol. Its IUPAC name is 4-tert-butyl-5-[(4-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-tert-butyl-5-[(4-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 141234580 |
| Molecular Formula | C23H28ClN3S |
| Molecular Weight | 414.02 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-tert-butyl-5-[(4-chlorophenyl)methyl]-N-[[4-(dimethylamino)phenyl]methyl]-1,3-thiazol-2-amine |
| SMILES | CN(C)c1ccc(CNc2nc(C(C)(C)C)c(Cc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C23H28ClN3S/c1-23(2,3)21-20(14-16-6-10-18(24)11-7-16)28-22(26-21)25-15-17-8-12-19(13-9-17)27(4)5/h6-13H,14-15H2,1-5H3,(H,25,26) |
| InChIKey | RKMGFGSVXYNIKL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.02 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|