C21H21Br2ClN2OS — CID 141234584
2,4-dibromo-6-[[[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]methyl]phenol (PubChem CID 141234584) has the molecular formula C21H21Br2ClN2OS and a molecular weight of 544.74 g/mol. Its IUPAC name is 2,4-dibromo-6-[[[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 141234584 |
| Molecular Formula | C21H21Br2ClN2OS |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 541.94 |
| IUPAC Name | 2,4-dibromo-6-[[[4-tert-butyl-5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]amino]methyl]phenol |
| SMILES | CC(C)(C)c1nc(NCc2cc(Br)cc(Br)c2O)sc1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21Br2ClN2OS/c1-21(2,3)19-17(8-12-4-6-15(24)7-5-12)28-20(26-19)25-11-13-9-14(22)10-16(23)18(13)27/h4-7,9-10,27H,8,11H2,1-3H3,(H,25,26) |
| InChIKey | XTLLJAYNLYEQRF-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|