C13H9BrClN3O2S — CID 141235326
7-benzylsulfonyl-5-bromo-4-chloropyrrolo[2,3-d]pyrimidine (PubChem CID 141235326) has the molecular formula C13H9BrClN3O2S and a molecular weight of 386.66 g/mol. Its IUPAC name is 7-benzylsulfonyl-5-bromo-4-chloropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-benzylsulfonyl-5-bromo-4-chloropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 141235326 |
| Molecular Formula | C13H9BrClN3O2S |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 7-benzylsulfonyl-5-bromo-4-chloropyrrolo[2,3-d]pyrimidine |
| SMILES | O=S(=O)(Cc1ccccc1)n1cc(Br)c2c(Cl)ncnc21 |
| InChI | InChI=1S/C13H9BrClN3O2S/c14-10-6-18(13-11(10)12(15)16-8-17-13)21(19,20)7-9-4-2-1-3-5-9/h1-6,8H,7H2 |
| InChIKey | GIVGXJNOJIJBNU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |