C15H11N3O2S — CID 175733704
1-benzylsulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile (PubChem CID 175733704) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-benzylsulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile.
| Compound Name | 1-benzylsulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 175733704 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 1-benzylsulfonylpyrrolo[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cnc2c(ccn2S(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H11N3O2S/c16-9-13-8-14-6-7-18(15(14)17-10-13)21(19,20)11-12-4-2-1-3-5-12/h1-8,10H,11H2 |
| InChIKey | ZVKLWOPPCZTEOC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |