C21H25N5O2S — CID 163387858
5-(7-benzylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2,5-diamine (PubChem CID 163387858) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 5-(7-benzylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2,5-diamine.
| Compound Name | 5-(7-benzylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2,5-diamine |
|---|---|
| PubChem CID | 163387858 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 5-(7-benzylsulfonylpyrrolo[2,3-d]pyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalene-2,5-diamine |
| SMILES | NC1CC2CC(N)(c3ncnc4c3ccn4S(=O)(=O)Cc3ccccc3)CC2C1 |
| InChI | InChI=1S/C21H25N5O2S/c22-17-8-15-10-21(23,11-16(15)9-17)19-18-6-7-26(20(18)25-13-24-19)29(27,28)12-14-4-2-1-3-5-14/h1-7,13,15-17H,8-12,22-23H2 |
| InChIKey | NCMPBOUNKMPGQG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |