C22H24N8O2S — CID 151848289
3-[4-(azidomethyl)piperidin-1-yl]-10-benzylsulfonyl-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 151848289) has the molecular formula C22H24N8O2S and a molecular weight of 464.56 g/mol. Its IUPAC name is 3-[4-(azidomethyl)piperidin-1-yl]-10-benzylsulfonyl-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[4-(azidomethyl)piperidin-1-yl]-10-benzylsulfonyl-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 151848289 |
| Molecular Formula | C22H24N8O2S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 3-[4-(azidomethyl)piperidin-1-yl]-10-benzylsulfonyl-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | Cc1nc2cnc3c(ccn3S(=O)(=O)Cc3ccccc3)c2n1N1CCC(CN=[N+]=[N-])CC1 |
| InChI | InChI=1S/C22H24N8O2S/c1-16-26-20-14-24-22-19(9-12-29(22)33(31,32)15-18-5-3-2-4-6-18)21(20)30(16)28-10-7-17(8-11-28)13-25-27-23/h2-6,9,12,14,17H,7-8,10-11,13,15H2,1H3 |
| InChIKey | SICYHSAZTOPRAP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|