C23H27N3O2S — CID 141383345
7-benzylsulfonyl-1-cyclohexyl-3,4-dihydro-2H-pyrrolo[2,3-h][1,6]naphthyridine (PubChem CID 141383345) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 7-benzylsulfonyl-1-cyclohexyl-3,4-dihydro-2H-pyrrolo[2,3-h][1,6]naphthyridine.
| Compound Name | 7-benzylsulfonyl-1-cyclohexyl-3,4-dihydro-2H-pyrrolo[2,3-h][1,6]naphthyridine |
|---|---|
| PubChem CID | 141383345 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 7-benzylsulfonyl-1-cyclohexyl-3,4-dihydro-2H-pyrrolo[2,3-h][1,6]naphthyridine |
| SMILES | O=S(=O)(Cc1ccccc1)n1ccc2c3c(cnc21)CCCN3C1CCCCC1 |
| InChI | InChI=1S/C23H27N3O2S/c27-29(28,17-18-8-3-1-4-9-18)26-15-13-21-22-19(16-24-23(21)26)10-7-14-25(22)20-11-5-2-6-12-20/h1,3-4,8-9,13,15-16,20H,2,5-7,10-12,14,17H2 |
| InChIKey | IPZQWKRGCDRSIC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |