C19H20N4O2S — CID 154853603
2-(5-benzylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)pyridine-4-carbonitrile (PubChem CID 154853603) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-(5-benzylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)pyridine-4-carbonitrile.
| Compound Name | 2-(5-benzylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 154853603 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(5-benzylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CC3CN(S(=O)(=O)Cc4ccccc4)CC3C2)c1 |
| InChI | InChI=1S/C19H20N4O2S/c20-9-16-6-7-21-19(8-16)22-10-17-12-23(13-18(17)11-22)26(24,25)14-15-4-2-1-3-5-15/h1-8,17-18H,10-14H2 |
| InChIKey | PUALTEUVAGVSOQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |