C19H22BN3O4S — CID 162353224
7-benzylsulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine (PubChem CID 162353224) has the molecular formula C19H22BN3O4S and a molecular weight of 399.28 g/mol. Its IUPAC name is 7-benzylsulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-benzylsulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 162353224 |
| Molecular Formula | C19H22BN3O4S |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 7-benzylsulfonyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
| SMILES | CC1(C)OB(c2ncc3ccn(S(=O)(=O)Cc4ccccc4)c3n2)OC1(C)C |
| InChI | InChI=1S/C19H22BN3O4S/c1-18(2)19(3,4)27-20(26-18)17-21-12-15-10-11-23(16(15)22-17)28(24,25)13-14-8-6-5-7-9-14/h5-12H,13H2,1-4H3 |
| InChIKey | SVZZICFBRCPRSG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|