C14H17N5O2S — CID 168916641
7-benzylsulfonyl-2-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 168916641) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 7-benzylsulfonyl-2-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 7-benzylsulfonyl-2-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 168916641 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 7-benzylsulfonyl-2-methyl-1H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CC1(N)N=C(N)c2ccn(S(=O)(=O)Cc3ccccc3)c2N1 |
| InChI | InChI=1S/C14H17N5O2S/c1-14(16)17-12(15)11-7-8-19(13(11)18-14)22(20,21)9-10-5-3-2-4-6-10/h2-8,18H,9,16H2,1H3,(H2,15,17) |
| InChIKey | HMTYQLUABXIAJN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |