C16H22ClN3O2S — CID 141237724
ethyl 2-amino-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate;hydrochloride (PubChem CID 141237724) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is ethyl 2-amino-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate;hydrochloride.
| Compound Name | ethyl 2-amino-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 141237724 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | ethyl 2-amino-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1=C(c2ccc(N(C)C)cc2)SC(N)N=C1C.Cl |
| InChI | InChI=1S/C16H21N3O2S.ClH/c1-5-21-15(20)13-10(2)18-16(17)22-14(13)11-6-8-12(9-7-11)19(3)4;/h6-9,16H,5,17H2,1-4H3;1H |
| InChIKey | VMNZWWKRUWKVLB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|