C18H23N3O3S — CID 141237729
ethyl 2-acetamido-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate (PubChem CID 141237729) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is ethyl 2-acetamido-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate.
| Compound Name | ethyl 2-acetamido-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate |
|---|---|
| PubChem CID | 141237729 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl 2-acetamido-6-[4-(dimethylamino)phenyl]-4-methyl-2H-1,3-thiazine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccc(N(C)C)cc2)SC(NC(C)=O)N=C1C |
| InChI | InChI=1S/C18H23N3O3S/c1-6-24-17(23)15-11(2)19-18(20-12(3)22)25-16(15)13-7-9-14(10-8-13)21(4)5/h7-10,18H,6H2,1-5H3,(H,20,22) |
| InChIKey | OKTFOWUETBQNLB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|