C27H33N3O6 — CID 141239079
[2-hydroxy-2-(pyridin-4-ylmethylamino)ethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate (PubChem CID 141239079) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is [2-hydroxy-2-(pyridin-4-ylmethylamino)ethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate.
| Compound Name | [2-hydroxy-2-(pyridin-4-ylmethylamino)ethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 141239079 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [2-hydroxy-2-(pyridin-4-ylmethylamino)ethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate |
| SMILES | COc1ccc2c(C3COC(CCCNC(=O)OCC(O)NCc4ccncc4)OC3)cccc2c1 |
| InChI | InChI=1S/C27H33N3O6/c1-33-22-7-8-24-20(14-22)4-2-5-23(24)21-16-34-26(35-17-21)6-3-11-29-27(32)36-18-25(31)30-15-19-9-12-28-13-10-19/h2,4-5,7-10,12-14,21,25-26,30-31H,3,6,11,15-18H2,1H3,(H,29,32) |
| InChIKey | RCFGZGSABSORFO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|