C23H32N2O6 — CID 141239089
[2-(ethylamino)-2-hydroxyethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate (PubChem CID 141239089) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is [2-(ethylamino)-2-hydroxyethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate.
| Compound Name | [2-(ethylamino)-2-hydroxyethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 141239089 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [2-(ethylamino)-2-hydroxyethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate |
| SMILES | CCNC(O)COC(=O)NCCCC1OCC(c2cccc3cc(OC)ccc23)CO1 |
| InChI | InChI=1S/C23H32N2O6/c1-3-24-21(26)15-31-23(27)25-11-5-8-22-29-13-17(14-30-22)19-7-4-6-16-12-18(28-2)9-10-20(16)19/h4,6-7,9-10,12,17,21-22,24,26H,3,5,8,11,13-15H2,1-2H3,(H,25,27) |
| InChIKey | MXSJDGSUBBCZIY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|