C24H49N — CID 141240247
(Z)-18,18-diethylicos-9-en-1-amine (PubChem CID 141240247) has the molecular formula C24H49N and a molecular weight of 351.66 g/mol. Its IUPAC name is (Z)-18,18-diethylicos-9-en-1-amine.
| Compound Name | (Z)-18,18-diethylicos-9-en-1-amine |
|---|---|
| PubChem CID | 141240247 |
| Molecular Formula | C24H49N |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 351.39 |
| IUPAC Name | (Z)-18,18-diethylicos-9-en-1-amine |
| SMILES | CCC(CC)(CC)CCCCCCC/C=C\CCCCCCCCN |
| InChI | InChI=1S/C24H49N/c1-4-24(5-2,6-3)22-20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-23-25/h7-8H,4-6,9-23,25H2,1-3H3/b8-7- |
| InChIKey | NUYLLIVIHRDIQV-FPLPWBNLSA-N |
| XLogP | 8.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|