C16H33I — CID 141246232
1-iodo-6-methyl-4,4-bis(2-methylpropyl)heptane (PubChem CID 141246232) has the molecular formula C16H33I and a molecular weight of 352.34 g/mol. Its IUPAC name is 1-iodo-6-methyl-4,4-bis(2-methylpropyl)heptane.
| Compound Name | 1-iodo-6-methyl-4,4-bis(2-methylpropyl)heptane |
|---|---|
| PubChem CID | 141246232 |
| Molecular Formula | C16H33I |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-iodo-6-methyl-4,4-bis(2-methylpropyl)heptane |
| SMILES | CC(C)CC(CCCI)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C16H33I/c1-13(2)10-16(8-7-9-17,11-14(3)4)12-15(5)6/h13-15H,7-12H2,1-6H3 |
| InChIKey | LJVZINBXASHEPD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|