C60H126 — CID 158412329
2,8-dimethyl-5-(3-methylbutyl)-5-(2-methylpropyl)nonane (PubChem CID 158412329) has the molecular formula C60H126 and a molecular weight of 847.67 g/mol. Its IUPAC name is 2,8-dimethyl-5-(3-methylbutyl)-5-(2-methylpropyl)nonane.
| Compound Name | 2,8-dimethyl-5-(3-methylbutyl)-5-(2-methylpropyl)nonane |
|---|---|
| PubChem CID | 158412329 |
| Molecular Formula | C60H126 |
| Molecular Weight | 847.67 g/mol |
| Exact Mass | 846.99 |
| IUPAC Name | 2,8-dimethyl-5-(3-methylbutyl)-5-(2-methylpropyl)nonane |
| SMILES | CC(C)CCC(CCC(C)C)(CCC(C)C)CC(C)C.CC(C)CCC(CCC(C)C)(CCC(C)C)CC(C)C.CC(C)CCC(CCC(C)C)(CCC(C)C)CC(C)C |
| InChI | InChI=1S/3C20H42/c3*1-16(2)9-12-20(15-19(7)8,13-10-17(3)4)14-11-18(5)6/h3*16-19H,9-15H2,1-8H3 |
| InChIKey | GZLTUXIRWPRAML-UHFFFAOYSA-N |
| XLogP | 21.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.67 |
| LogP ≤ 5 | 21.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |