C48H100 — CID 167654054
5-(3,3-dimethylbutyl)-2,2,8,8-tetramethyl-5-(3-methylbutyl)nonane (PubChem CID 167654054) has the molecular formula C48H100 and a molecular weight of 677.33 g/mol. Its IUPAC name is 5-(3,3-dimethylbutyl)-2,2,8,8-tetramethyl-5-(3-methylbutyl)nonane.
| Compound Name | 5-(3,3-dimethylbutyl)-2,2,8,8-tetramethyl-5-(3-methylbutyl)nonane |
|---|---|
| PubChem CID | 167654054 |
| Molecular Formula | C48H100 |
| Molecular Weight | 677.33 g/mol |
| Exact Mass | 676.78 |
| IUPAC Name | 5-(3,3-dimethylbutyl)-2,2,8,8-tetramethyl-5-(3-methylbutyl)nonane |
| SMILES | CC(C)CCC(CCC(C)(C)C)(CCC(C)(C)C)CCC(C)(C)C.CC(C)CCC(CCC(C)(C)C)(CCC(C)(C)C)CCC(C)(C)C |
| InChI | InChI=1S/2C24H50/c2*1-20(2)12-13-24(17-14-21(3,4)5,18-15-22(6,7)8)19-16-23(9,10)11/h2*20H,12-19H2,1-11H3 |
| InChIKey | QZKDLVKDYFVMOL-UHFFFAOYSA-N |
| XLogP | 17.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.33 |
| LogP ≤ 5 | 17.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |