C12H25Cl3O4Si — CID 141248332
[8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane (PubChem CID 141248332) has the molecular formula C12H25Cl3O4Si and a molecular weight of 367.77 g/mol. Its IUPAC name is [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane.
| Compound Name | [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane |
|---|---|
| PubChem CID | 141248332 |
| Molecular Formula | C12H25Cl3O4Si |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane |
| SMILES | O[Si](O)(O)OCCCCCC(CCCl)(CCCl)CCCl |
| InChI | InChI=1S/C12H25Cl3O4Si/c13-8-5-12(6-9-14,7-10-15)4-2-1-3-11-19-20(16,17)18/h16-18H,1-11H2 |
| InChIKey | WYRMZHLZWPEHCH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|