About [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane
[8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane (PubChem CID 141248332) has the molecular formula C12H25Cl3O4Si
and a molecular weight of 367.77 g/mol. Its IUPAC name is [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane.
Molecular Properties
| Compound Name | [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane |
| PubChem CID | 141248332 |
| Molecular Formula | C12H25Cl3O4Si |
| Molecular Weight | 367.77 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane |
| SMILES | O[Si](O)(O)OCCCCCC(CCCl)(CCCl)CCCl |
| InChI | InChI=1S/C12H25Cl3O4Si/c13-8-5-12(6-9-14,7-10-15)4-2-1-3-11-19-20(16,17)18/h16-18H,1-11H2 |
| InChIKey | WYRMZHLZWPEHCH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane?
The IUPAC name of [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane (CID 141248332) is [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane.
What is the SMILES notation for [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane?
The canonical SMILES for [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane is O[Si](O)(O)OCCCCCC(CCCl)(CCCl)CCCl.
What is the InChIKey of [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane?
The InChIKey is WYRMZHLZWPEHCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25Cl3O4Si/c13-8-5-12(6-9-14,7-10-15)4-2-1-3-11-19-20(16,17)18/h16-18H,1-11H2.
What are the key properties of [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane?
[8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane has a molecular weight of 367.77 g/mol, XLogP of 2.85, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-chloro-6,6-bis(2-chloroethyl)octoxy]-trihydroxysilane is sourced from PubChem (CID 141248332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).