C14H22NNaO3 — CID 141249552
sodium 11-(prop-2-enoylamino)undec-2-enoate (PubChem CID 141249552) has the molecular formula C14H22NNaO3 and a molecular weight of 275.32 g/mol. Its IUPAC name is sodium 11-(prop-2-enoylamino)undec-2-enoate.
| Compound Name | sodium 11-(prop-2-enoylamino)undec-2-enoate |
|---|---|
| PubChem CID | 141249552 |
| Molecular Formula | C14H22NNaO3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | sodium 11-(prop-2-enoylamino)undec-2-enoate |
| SMILES | C=CC(=O)NCCCCCCCCC=CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H23NO3.Na/c1-2-13(16)15-12-10-8-6-4-3-5-7-9-11-14(17)18;/h2,9,11H,1,3-8,10,12H2,(H,15,16)(H,17,18);/q;+1/p-1 |
| InChIKey | HBRZZRFCLUTLOU-UHFFFAOYSA-M |
| XLogP | -1.67 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|