C16H30N2O7 — CID 141253409
(1S,3S,4S,5S)-4,5-bis(aminomethyl)-2-propan-2-ylcyclopentane-1,3-diol;3-hydroxycyclobutane-1,1-dicarboxylic acid (PubChem CID 141253409) has the molecular formula C16H30N2O7 and a molecular weight of 362.42 g/mol. Its IUPAC name is (1S,3S,4S,5S)-4,5-bis(aminomethyl)-2-propan-2-ylcyclopentane-1,3-diol;3-hydroxycyclobutane-1,1-dicarboxylic acid.
| Compound Name | (1S,3S,4S,5S)-4,5-bis(aminomethyl)-2-propan-2-ylcyclopentane-1,3-diol;3-hydroxycyclobutane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 141253409 |
| Molecular Formula | C16H30N2O7 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,3S,4S,5S)-4,5-bis(aminomethyl)-2-propan-2-ylcyclopentane-1,3-diol;3-hydroxycyclobutane-1,1-dicarboxylic acid |
| SMILES | CC(C)C1[C@@H](O)[C@H](CN)[C@@H](CN)[C@@H]1O.O=C(O)C1(C(=O)O)CC(O)C1 |
| InChI | InChI=1S/C10H22N2O2.C6H8O5/c1-5(2)8-9(13)6(3-11)7(4-12)10(8)14;7-3-1-6(2-3,4(8)9)5(10)11/h5-10,13-14H,3-4,11-12H2,1-2H3;3,7H,1-2H2,(H,8,9)(H,10,11)/t6-,7-,9+,10+;/m1./s1 |
| InChIKey | USZIKKILQOQJAB-KHRSZWCGSA-N |
| XLogP | -1.56 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|