C13H22N2O5 — CID 141253888
7-O-tert-butyl 1-O-methyl 3-(hydroxyamino)-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate (PubChem CID 141253888) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-methyl 3-(hydroxyamino)-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 1-O-methyl 3-(hydroxyamino)-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 141253888 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 7-O-tert-butyl 1-O-methyl 3-(hydroxyamino)-7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
| SMILES | COC(=O)C12CCC(C(NO)C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N2O5/c1-12(2,3)20-11(17)15-9-5-6-13(15,10(16)19-4)7-8(9)14-18/h8-9,14,18H,5-7H2,1-4H3 |
| InChIKey | KWEOBQUMJXLLLU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|