About (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate
(4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate (PubChem CID 141253966) has the molecular formula C26H20N2O6S
and a molecular weight of 488.52 g/mol. Its IUPAC name is (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate.
Molecular Properties
| Compound Name | (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate |
| PubChem CID | 141253966 |
| Molecular Formula | C26H20N2O6S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate |
| SMILES | Nc1ccc(OC(=O)c2ccc(S(=O)(=O)c3ccc(C(=O)Oc4ccc(N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O6S/c27-19-5-9-21(10-6-19)33-25(29)17-1-13-23(14-2-17)35(31,32)24-15-3-18(4-16-24)26(30)34-22-11-7-20(28)8-12-22/h1-16H,27-28H2 |
| InChIKey | UCDSSLXPPKJGLQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate?
The IUPAC name of (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate (CID 141253966) is (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate.
What is the SMILES notation for (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate?
The canonical SMILES for (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate is Nc1ccc(OC(=O)c2ccc(S(=O)(=O)c3ccc(C(=O)Oc4ccc(N)cc4)cc3)cc2)cc1.
What is the InChIKey of (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate?
The InChIKey is UCDSSLXPPKJGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O6S/c27-19-5-9-21(10-6-19)33-25(29)17-1-13-23(14-2-17)35(31,32)24-15-3-18(4-16-24)26(30)34-22-11-7-20(28)8-12-22/h1-16H,27-28H2.
What are the key properties of (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate?
(4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate has a molecular weight of 488.52 g/mol, XLogP of 4.12, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl) 4-[4-(4-aminophenoxy)carbonylphenyl]sulfonylbenzoate is sourced from PubChem (CID 141253966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).