C17H22N4O3S2 — CID 141254307
tert-butyl (2S,4S)-2-[amino(1,3-benzothiazol-2-yl)amino]-2-formyl-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 141254307) has the molecular formula C17H22N4O3S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[amino(1,3-benzothiazol-2-yl)amino]-2-formyl-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[amino(1,3-benzothiazol-2-yl)amino]-2-formyl-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141254307 |
| Molecular Formula | C17H22N4O3S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | tert-butyl (2S,4S)-2-[amino(1,3-benzothiazol-2-yl)amino]-2-formyl-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](S)C[C@@]1(C=O)N(N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H22N4O3S2/c1-16(2,3)24-15(23)20-9-11(25)8-17(20,10-22)21(18)14-19-12-6-4-5-7-13(12)26-14/h4-7,10-11,25H,8-9,18H2,1-3H3/t11-,17-/m0/s1 |
| InChIKey | AUMMZYPBXIYPSZ-GTNSWQLSSA-N |
| XLogP | 2.81 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|