C19H28N4O3S — CID 141179903
tert-butyl (2S,4S)-2-formyl-2-(4-pyrimidin-2-ylpiperidin-1-yl)-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 141179903) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-formyl-2-(4-pyrimidin-2-ylpiperidin-1-yl)-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-formyl-2-(4-pyrimidin-2-ylpiperidin-1-yl)-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141179903 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl (2S,4S)-2-formyl-2-(4-pyrimidin-2-ylpiperidin-1-yl)-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](S)C[C@]1(C=O)N1CCC(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H28N4O3S/c1-18(2,3)26-17(25)23-12-15(27)11-19(23,13-24)22-9-5-14(6-10-22)16-20-7-4-8-21-16/h4,7-8,13-15,27H,5-6,9-12H2,1-3H3/t15-,19-/m0/s1 |
| InChIKey | GVTLAXHRFXDTHY-KXBFYZLASA-N |
| XLogP | 2.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|