C16H24N2O4S — CID 141242380
tert-butyl (2S,4S)-2-formyl-2-[(3-oxocyclohexen-1-yl)amino]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 141242380) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-formyl-2-[(3-oxocyclohexen-1-yl)amino]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-formyl-2-[(3-oxocyclohexen-1-yl)amino]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141242380 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | tert-butyl (2S,4S)-2-formyl-2-[(3-oxocyclohexen-1-yl)amino]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](S)C[C@]1(C=O)NC1=CC(=O)CCC1 |
| InChI | InChI=1S/C16H24N2O4S/c1-15(2,3)22-14(21)18-9-13(23)8-16(18,10-19)17-11-5-4-6-12(20)7-11/h7,10,13,17,23H,4-6,8-9H2,1-3H3/t13-,16-/m0/s1 |
| InChIKey | UQOJWMFINBLEEY-BBRMVZONSA-N |
| XLogP | 2.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|