C18H8F8O6S — CID 141254562
4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 141254562) has the molecular formula C18H8F8O6S and a molecular weight of 504.31 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 141254562 |
| Molecular Formula | C18H8F8O6S |
| Molecular Weight | 504.31 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxybut-2-ynyl 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1c(F)c(F)cc(C(=O)OCC#CCOS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C18H8F8O6S/c1-30-16-9(20)7(6-8(19)10(16)21)18(27)31-4-2-3-5-32-33(28,29)17-14(25)12(23)11(22)13(24)15(17)26/h6H,4-5H2,1H3 |
| InChIKey | ZYNRDALGPYNTQZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|