C23H44O8 — CID 141254740
9-[2,2-bis(2-butoxyethoxy)ethoxy]-9-oxononanoic acid (PubChem CID 141254740) has the molecular formula C23H44O8 and a molecular weight of 448.60 g/mol. Its IUPAC name is 9-[2,2-bis(2-butoxyethoxy)ethoxy]-9-oxononanoic acid.
| Compound Name | 9-[2,2-bis(2-butoxyethoxy)ethoxy]-9-oxononanoic acid |
|---|---|
| PubChem CID | 141254740 |
| Molecular Formula | C23H44O8 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 9-[2,2-bis(2-butoxyethoxy)ethoxy]-9-oxononanoic acid |
| SMILES | CCCCOCCOC(COC(=O)CCCCCCCC(=O)O)OCCOCCCC |
| InChI | InChI=1S/C23H44O8/c1-3-5-14-27-16-18-29-23(30-19-17-28-15-6-4-2)20-31-22(26)13-11-9-7-8-10-12-21(24)25/h23H,3-20H2,1-2H3,(H,24,25) |
| InChIKey | GUQVNHLPASRRGQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|