C16H17ClN4 — CID 141255090
2-chloro-3-methyl-4-[2-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]benzonitrile (PubChem CID 141255090) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-chloro-3-methyl-4-[2-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 2-chloro-3-methyl-4-[2-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 141255090 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-chloro-3-methyl-4-[2-(5-methyl-1H-imidazol-2-yl)pyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1cnc(C2CCCN2c2ccc(C#N)c(Cl)c2C)[nH]1 |
| InChI | InChI=1S/C16H17ClN4/c1-10-9-19-16(20-10)14-4-3-7-21(14)13-6-5-12(8-18)15(17)11(13)2/h5-6,9,14H,3-4,7H2,1-2H3,(H,19,20) |
| InChIKey | SXXCKORXOLPIEQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |