C21H27ClN2O2S — CID 143332847
(Z)-but-2-ene;2-chloro-3-methyl-4-[2-[(1E)-3-methylsulfonylbuta-1,3-dienyl]pyrrolidin-1-yl]benzonitrile (PubChem CID 143332847) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is (Z)-but-2-ene;2-chloro-3-methyl-4-[2-[(1E)-3-methylsulfonylbuta-1,3-dienyl]pyrrolidin-1-yl]benzonitrile.
| Compound Name | (Z)-but-2-ene;2-chloro-3-methyl-4-[2-[(1E)-3-methylsulfonylbuta-1,3-dienyl]pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 143332847 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (Z)-but-2-ene;2-chloro-3-methyl-4-[2-[(1E)-3-methylsulfonylbuta-1,3-dienyl]pyrrolidin-1-yl]benzonitrile |
| SMILES | C/C=C\C.C=C(/C=C/C1CCCN1c1ccc(C#N)c(Cl)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C17H19ClN2O2S.C4H8/c1-12(23(3,21)22)6-8-15-5-4-10-20(15)16-9-7-14(11-19)17(18)13(16)2;1-3-4-2/h6-9,15H,1,4-5,10H2,2-3H3;3-4H,1-2H3/b8-6+;4-3- |
| InChIKey | JQWBRGVOIOMNOT-JHUMDWJLSA-N |
| XLogP | 5.19 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|