C16H15ClF3N3O4S — CID 59754215
[(1S,7R,7aR)-2-(3-chloro-4-cyano-2-methylphenyl)-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl] methanesulfonate (PubChem CID 59754215) has the molecular formula C16H15ClF3N3O4S and a molecular weight of 437.83 g/mol. Its IUPAC name is [(1S,7R,7aR)-2-(3-chloro-4-cyano-2-methylphenyl)-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl] methanesulfonate.
| Compound Name | [(1S,7R,7aR)-2-(3-chloro-4-cyano-2-methylphenyl)-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 59754215 |
| Molecular Formula | C16H15ClF3N3O4S |
| Molecular Weight | 437.83 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | [(1S,7R,7aR)-2-(3-chloro-4-cyano-2-methylphenyl)-3-oxo-1-(trifluoromethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-7-yl] methanesulfonate |
| SMILES | Cc1c(N2C(=O)N3CC[C@@H](OS(C)(=O)=O)[C@H]3[C@H]2C(F)(F)F)ccc(C#N)c1Cl |
| InChI | InChI=1S/C16H15ClF3N3O4S/c1-8-10(4-3-9(7-21)12(8)17)23-14(16(18,19)20)13-11(27-28(2,25)26)5-6-22(13)15(23)24/h3-4,11,13-14H,5-6H2,1-2H3/t11-,13+,14+/m1/s1 |
| InChIKey | OXSXUTGWHDBYCU-XBFCOCLRSA-N |
| XLogP | 2.81 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.83 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|